5-nitro-2-(trifluoromethyl)pyrimidine-4,6-diamine structure
|
Common Name | 5-nitro-2-(trifluoromethyl)pyrimidine-4,6-diamine | ||
|---|---|---|---|---|
| CAS Number | 1513-74-2 | Molecular Weight | 223.11300 | |
| Density | 1.773g/cm3 | Boiling Point | 335.4ºC at 760 mmHg | |
| Molecular Formula | C5H4F3N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.6ºC | |
| Name | 5-nitro-2-(trifluoromethyl)pyrimidine-4,6-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.773g/cm3 |
|---|---|
| Boiling Point | 335.4ºC at 760 mmHg |
| Molecular Formula | C5H4F3N5O2 |
| Molecular Weight | 223.11300 |
| Flash Point | 156.6ºC |
| Exact Mass | 223.03200 |
| PSA | 124.37000 |
| LogP | 1.60250 |
| Vapour Pressure | 0.00012mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | ZQOKVPMMZCLXPQ-UHFFFAOYSA-N |
| SMILES | Nc1nc(C(F)(F)F)nc(N)c1[N+](=O)[O-] |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-nitro-2-trifluoromethyl-pyrimidine-4,6-diamine |
| 5-Nitro-4,6-diamino-2-trifluormethyl-pyrimidin |