5-nitro-2-phenyl-pyrimidine-4,6-diamine
Modify Date: 2025-08-25 12:12:58
5-nitro-2-phenyl-pyrimidine-4,6-diamine structure
|
Common Name | 5-nitro-2-phenyl-pyrimidine-4,6-diamine | ||
|---|---|---|---|---|
| CAS Number | 3346-20-1 | Molecular Weight | 231.21100 | |
| Density | 1.467g/cm3 | Boiling Point | 365.5ºC at 760 mmHg | |
| Molecular Formula | C10H9N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.8ºC | |
| Name | 5-nitro-2-phenylpyrimidine-4,6-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.467g/cm3 |
|---|---|
| Boiling Point | 365.5ºC at 760 mmHg |
| Molecular Formula | C10H9N5O2 |
| Molecular Weight | 231.21100 |
| Flash Point | 174.8ºC |
| Exact Mass | 231.07600 |
| PSA | 123.64000 |
| LogP | 2.90180 |
| Index of Refraction | 1.717 |
| InChIKey | ITRVIIQLOSKPSR-UHFFFAOYSA-N |
| SMILES | Nc1nc(-c2ccccc2)nc(N)c1[N+](=O)[O-] |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Nitro-4,6-diamino-2-phenyl-pyrimidin |
| 5-nitro-2-phenyl-pyrimidine-4,6-diamine |