perfluoroisopentyl iodide structure
|
Common Name | perfluoroisopentyl iodide | ||
|---|---|---|---|---|
| CAS Number | 1514-90-5 | Molecular Weight | 395.94000 | |
| Density | 2,045 g/cm3 | Boiling Point | 89-90°C | |
| Molecular Formula | C5F11I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 33.6ºC | |
| Name | 1,1,1,2,3,3,4,4-octafluoro-4-iodo-2-(trifluoromethyl)butane |
|---|---|
| Synonym | More Synonyms |
| Density | 2,045 g/cm3 |
|---|---|
| Boiling Point | 89-90°C |
| Molecular Formula | C5F11I |
| Molecular Weight | 395.94000 |
| Flash Point | 33.6ºC |
| Exact Mass | 395.88700 |
| LogP | 4.48240 |
| Vapour Pressure | 49.6mmHg at 25°C |
| Index of Refraction | 1.334 |
| InChIKey | UMPRKACBONFPEQ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)(F)I |
| Stability | Stable. |
| Hazard Codes | T |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2903799090 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| PC6089B |
| 2-trifluoromethylperfluorobutyl iodide |
| 3-trifluoromethylperfluorobutyl iodide |
| 1-Iod-perfluor-isopentan |
| 1,1,1,2,3,3,4,4-octafluoro-4-iodo-2-trifluoromethyl-butane |
| perfluoro-1-iodoisopentane |
| 1-Iod-undecafluor-3-methyl-butan |
| Perfluoro-3-methylbutyl iodide |
| MFCD00153244 |
| Perfluoroisopentyl iodide |