1,1,1,2,3,3,4,4,5,5,6,6,7,8,8,8-hexadecafluoro-2,7-bis(trifluoromethyl)octane structure
|
Common Name | 1,1,1,2,3,3,4,4,5,5,6,6,7,8,8,8-hexadecafluoro-2,7-bis(trifluoromethyl)octane | ||
|---|---|---|---|---|
| CAS Number | 3021-63-4 | Molecular Weight | 538.07200 | |
| Density | 1.713g/cm3 | Boiling Point | 155.4ºC at 760mmHg | |
| Molecular Formula | C10F22 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 56.7ºC | |
| Name | 1,1,1,2,3,3,4,4,5,5,6,6,7,8,8,8-hexadecafluoro-2,7-bis(trifluoromethyl)octane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.713g/cm3 |
|---|---|
| Boiling Point | 155.4ºC at 760mmHg |
| Molecular Formula | C10F22 |
| Molecular Weight | 538.07200 |
| Flash Point | 56.7ºC |
| Exact Mass | 537.96500 |
| LogP | 7.19340 |
| Index of Refraction | 1.283 |
| InChIKey | OBAVAMUHCSFDSY-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2903399090 |
|
~73%
1,1,1,2,3,3,4,4... CAS#:3021-63-4 |
| Literature: Eapen, Kalathil C.; Chen, Loomis S.; Chen, Grace J. Journal of Fluorine Chemistry, 1997 , vol. 81, # 2 p. 143 - 151 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903399090 |
|---|---|
| Summary | 2903399090. brominated,fluorinated or iodinated derivatives of acyclic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2H,7H-hexadecafluoro-2,7-bis-trifluoromethyl-octane |
| Perfluoroalcane-C8 |
| PERFLUORO-2,7-DIMETHYLOCTANE |
| Perfluor-2,7-dimethyl-octan |