2-Propenoic acid,2-cyano-3-(4-methoxyphenyl)- structure
|
Common Name | 2-Propenoic acid,2-cyano-3-(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 1519-55-7 | Molecular Weight | 203.19400 | |
| Density | 1.28g/cm3 | Boiling Point | 392.8ºC at 760 mmHg | |
| Molecular Formula | C11H9NO3 | Melting Point | 230-234ºC(lit.) | |
| MSDS | N/A | Flash Point | 191.4ºC | |
| Name | α-CYANO-4-METHOXYCINNAMIC ACID |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 392.8ºC at 760 mmHg |
| Melting Point | 230-234ºC(lit.) |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.19400 |
| Flash Point | 191.4ºC |
| Exact Mass | 203.05800 |
| PSA | 70.32000 |
| LogP | 1.68678 |
| Vapour Pressure | 7.09E-07mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | KMHNRJDDHTZZDZ-RMKNXTFCSA-N |
| SMILES | COc1ccc(C=C(C#N)C(=O)O)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2926909090 |
|
~97%
2-Propenoic aci... CAS#:1519-55-7 |
| Literature: Guyot, J.; Kergomard, A. Tetrahedron, 1983 , vol. 39, # 7 p. 1167 - 1179 |
|
~%
2-Propenoic aci... CAS#:1519-55-7 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. <2> 50, p. 18 |
|
~%
2-Propenoic aci... CAS#:1519-55-7 |
| Literature: Journal of the Chemical Society, , vol. 121, p. 1701 |
|
~%
2-Propenoic aci... CAS#:1519-55-7 |
| Literature: Chemische Berichte, , vol. 44, p. 275 |
|
~%
2-Propenoic aci... CAS#:1519-55-7 |
| Literature: DE164296 ; |
|
~%
2-Propenoic aci... CAS#:1519-55-7 |
| Literature: DE164296 ; |
| Precursor 6 | |
|---|---|
| DownStream 3 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-METHOXYBENZYLIDENECYANOACETIC ACID |
| 1-carboxy-1-cyano-2-(4-methoxyphenyl)ethylene |
| 2-Cyan-3-(4-methoxy-phenyl)-acrylsaeure |
| Anisalcyanessigsaeure |
| 2-cyano-3-(4-methoxy-phenyl)-acrylic acid |
| 4-Methoxy-benzalmalonsaeure-mononitril |
| MFCD00051722 |
| Anisylidencyanessigsaeure |
| a-Cyano-4-methoxycinnamic acid |