FGF basic (119-126) (human, bovine, ovine, rabbit) structure
|
Common Name | FGF basic (119-126) (human, bovine, ovine, rabbit) | ||
|---|---|---|---|---|
| CAS Number | 152051-61-1 | Molecular Weight | 993.16 | |
| Density | 1.43±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C44H76N14O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of FGF basic (119-126) (human, bovine, ovine, rabbit)bFGF (119-126) is a biological active peptide. (This peptide corresponds to human, bovine (119-126), mouse, rat (118-125) and Heparin-Binding Growth Factor 2 (118-125) residues of bFGF. It inhibits dimerization and activation of bFGF receptors.) |
| Name | bFGF (119-126), Basic Fibroblast Growth Factor, human, bovine,KRTGQYKL |
|---|---|
| Synonym | More Synonyms |
| Description | bFGF (119-126) is a biological active peptide. (This peptide corresponds to human, bovine (119-126), mouse, rat (118-125) and Heparin-Binding Growth Factor 2 (118-125) residues of bFGF. It inhibits dimerization and activation of bFGF receptors.) |
|---|---|
| Related Catalog |
| Density | 1.43±0.1 g/cm3 |
|---|---|
| Molecular Formula | C44H76N14O12 |
| Molecular Weight | 993.16 |
| Exact Mass | 992.57700 |
| PSA | 464.51000 |
| LogP | 2.31370 |
| InChIKey | KCDSBTNBXZKKLC-UHFFFAOYSA-N |
| SMILES | CC(C)CC(NC(=O)C(CCCCN)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CCC(N)=O)NC(=O)CNC(=O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCCCN)C(C)O)C(=O)O |
| Water Solubility | Freely soluble (690 g/L) (25 ºC) |
| h-lys-arg-thr-gly-gln-tyr-lys-leu-oh |
| krtgqykl |
| fgf basic (118-125) (mouse,rat) |
| fgf (119-126) |
| bfgf (119-126) (human,bovine,ovine,rabbit) |
| fgf basic (120-127) (short-tailed grey opossum) |
| hbgf-2 (119-126) (human,bovine,ovine,rabbit) |
| fgf basic (119-126) (human) |
| bfgf (119-126),human,bovine |
| lys-arg-thr-gly-gln-tyr-lys-leu |
| basic fibroblast growth factor,human,bovine |
| ARG-THR-GLY-GLN-TYR-LYS-LEU |
| FGF basic (119-126) (human, bovine, ovine, rabbit) |
| L-Lysyl-L-arginyl-L-threonylglycyl-L-glutaminyl-L-tyrosyl-L-lysyl-L-leucine |