tetrakis(2,3,4,5,6-pentafluorophenyl)silane structure
|
Common Name | tetrakis(2,3,4,5,6-pentafluorophenyl)silane | ||
|---|---|---|---|---|
| CAS Number | 1524-78-3 | Molecular Weight | 696.31000 | |
| Density | 1.76g/cm3 | Boiling Point | 413.1ºC at 760mmHg | |
| Molecular Formula | C24F20Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.6ºC | |
| Name | tetrakis(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.76g/cm3 |
|---|---|
| Boiling Point | 413.1ºC at 760mmHg |
| Molecular Formula | C24F20Si |
| Molecular Weight | 696.31000 |
| Flash Point | 203.6ºC |
| Exact Mass | 695.94500 |
| LogP | 5.84600 |
| Vapour Pressure | 1.18E-06mmHg at 25°C |
| Index of Refraction | 1.48 |
| InChIKey | PVEYHXXYHXDHBS-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c([Si](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| HS Code | 2931900090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| perfluorotetraphenylsilane |