1,4-Naphthalenedione,2-chloro-3-hydroxy- structure
|
Common Name | 1,4-Naphthalenedione,2-chloro-3-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 1526-73-4 | Molecular Weight | 208.59800 | |
| Density | 1.56g/cm3 | Boiling Point | 351.2ºC at 760mmHg | |
| Molecular Formula | C10H5ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.2ºC | |
| Name | 3-chloro-4-hydroxynaphthalene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 351.2ºC at 760mmHg |
| Molecular Formula | C10H5ClO3 |
| Molecular Weight | 208.59800 |
| Flash Point | 166.2ºC |
| Exact Mass | 207.99300 |
| PSA | 54.37000 |
| LogP | 2.07400 |
| Vapour Pressure | 1.55E-05mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | FQTBBCHDEDQCQR-UHFFFAOYSA-N |
| SMILES | O=C1C(=O)c2ccccc2C(O)=C1Cl |
| HS Code | 2914700090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 7 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-chloro-3-hydroxynaphthoquinone |
| 2-hydroxy-3-chloro-1,4-naphthoquinone |
| 3-chloro-2-hydroxy-1,4-naphthoquinone |
| 3-chloro-2-hydroxy-naphthalene-1,4-dione |
| 1,2-chloro-3-hydroxy |
| 3-chlorolawsone |
| 3-chloro-1,4-dihydro-1,4-dioxo-2-hydroxynaphthalene |
| 2-CHLORO-3-HYDROXY-1,4-NAPHTHOQUINONE |