Cimiside B structure
|
Common Name | Cimiside B | ||
|---|---|---|---|---|
| CAS Number | 152685-91-1 | Molecular Weight | 752.928 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C40H64O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cimiside BCimiside B, a glycoside alkaloid, isolated from the rhizome of Cimicifuga dahurica. |
| Name | Cimiside B |
|---|---|
| Synonym | More Synonyms |
| Description | Cimiside B, a glycoside alkaloid, isolated from the rhizome of Cimicifuga dahurica. |
|---|---|
| Related Catalog |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C40H64O13 |
| Molecular Weight | 752.928 |
| Exact Mass | 752.434692 |
| PSA | 196.99000 |
| LogP | 5.88 |
| Index of Refraction | 1.621 |
| InChIKey | FQXVWSGUAKXSLO-CKLOPMIDSA-N |
| SMILES | CC1CC2OC3(OC2C(C)(C)O)C1C1(C)CCC24CC25CCC(OC2OCC(O)C(OC6OCC(O)C(O)C6O)C2O)C(C)(C)C5CCC4C1(C)C3O |
| Hazard Codes | Xi |
|---|
| β-D-Xylopyranoside, (2S,4aR,5aS,7aR,7bR,8R,10R,11S,12aS,13R,13aS,13bR,15aR)-heptadecahydro-13-hydroxy-11-(1-hydroxy-1-methylethyl)-1,1,7a,8,13a-pentamethyl-10,12a-epoxy-2H,5H-cyclopropa[1',8'a]naph th[2',1':4,5]indeno[2,1-b]oxepin-2-yl 3-O-β-D-xylopyranosyl- |
| (1S,2R,3S,4R,7R,9S,12R,14S,17R,18R,19R,21R,22S)-2-Hydroxy-22-(2-hydroxy-2-propanyl)-3,8,8,17,19-pentamethyl-23,24-dioxaheptacyclo[19.2.1.0.0.0.0.0]tetracos-9-yl 3-O-β -D-xylopyranosyl-β-D-xylopyranoside |