Clibucaine structure
|
Common Name | Clibucaine | ||
|---|---|---|---|---|
| CAS Number | 15302-10-0 | Molecular Weight | 315.24 | |
| Density | 1.255g/cm3 | Boiling Point | 466.8ºC at 760mmHg | |
| Molecular Formula | C15H20Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.1ºC | |
Use of ClibucaineClibucaine is a piperidine derivative possessing local anesthetic properties. Clibucaine can be used as a local anesthetic agent[1]. |
| Name | N-(2,4-dichlorophenyl)-3-piperidin-1-ylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Description | Clibucaine is a piperidine derivative possessing local anesthetic properties. Clibucaine can be used as a local anesthetic agent[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 466.8ºC at 760mmHg |
| Molecular Formula | C15H20Cl2N2O |
| Molecular Weight | 315.24 |
| Flash Point | 236.1ºC |
| Exact Mass | 314.09500 |
| PSA | 35.83000 |
| LogP | 4.78380 |
| Vapour Pressure | 6.86E-09mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | GDDYCOSWVJRUHM-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)Nc1ccc(Cl)cc1Cl)N1CCCCC1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2933399090 |
|---|
|
~%
Clibucaine CAS#:15302-10-0 |
| Literature: Wilder Smith; Hofstetter Helvetica Chimica Acta, 1955 , vol. 38, p. 1085,1089,1091 |
|
~%
Clibucaine CAS#:15302-10-0 |
| Literature: Wilder Smith; Hofstetter Helvetica Chimica Acta, 1955 , vol. 38, p. 1085,1089,1091 |
|
~%
Clibucaine CAS#:15302-10-0 |
| Literature: Wilder Smith; Hofstetter Helvetica Chimica Acta, 1955 , vol. 38, p. 1085,1089,1091 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Clibucaina |
| 3-Piperidino-buttersaeure-(2,4-dichlor-anilid) |
| Clibucaine |
| Clibucaina [INN-Spanish] |
| 3-piperidino-butyric acid-(2,4-dichloro-anilide) |
| Clibucainum [INN-Latin] |