2,4-Bis(trifluoromethyl)phenylboronic acid structure
|
Common Name | 2,4-Bis(trifluoromethyl)phenylboronic acid | ||
|---|---|---|---|---|
| CAS Number | 153254-09-2 | Molecular Weight | 257.926 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 245.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C8H5BF6O2 | Melting Point | 148-150 | |
| MSDS | Chinese USA | Flash Point | 102.2±30.1 °C | |
| Name | 2,4-Bis(trifluoromethyl)phenylboronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 245.4±50.0 °C at 760 mmHg |
| Melting Point | 148-150 |
| Molecular Formula | C8H5BF6O2 |
| Molecular Weight | 257.926 |
| Flash Point | 102.2±30.1 °C |
| Exact Mass | 258.028687 |
| PSA | 40.46000 |
| LogP | 3.01 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.420 |
| InChIKey | WLYPBMBWKYALCG-UHFFFAOYSA-N |
| SMILES | OB(O)c1ccc(C(F)(F)F)cc1C(F)(F)F |
| Hazard Codes | C,Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2931900090 |
|
~%
2,4-Bis(trifluo... CAS#:153254-09-2 |
| Literature: US2009/36460 A1, ; Page/Page column 7; 8 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| [2,4-Bis(trifluoromethyl)phenyl]boronic acid |
| Boronic acid, B-[2,4-bis(trifluoromethyl)phenyl]- |
| 2,4-Bis(trifluoromethyl)benzeneboronic acid |
| 2,4-Bis(trifluoromethyl)phenylboronic acid |
| MFCD01631349 |