2,4-Bis(trifluoromethyl)phenylacetic acid structure
|
Common Name | 2,4-Bis(trifluoromethyl)phenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 177952-39-5 | Molecular Weight | 272.144 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 235.1±35.0 °C at 760 mmHg | |
| Molecular Formula | C10H6F6O2 | Melting Point | 33-35 °C(lit.) | |
| MSDS | N/A | Flash Point | 96.0±25.9 °C | |
| Name | 2-[2,4-bis(trifluoromethyl)phenyl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 235.1±35.0 °C at 760 mmHg |
| Melting Point | 33-35 °C(lit.) |
| Molecular Formula | C10H6F6O2 |
| Molecular Weight | 272.144 |
| Flash Point | 96.0±25.9 °C |
| Exact Mass | 272.027191 |
| PSA | 37.30000 |
| LogP | 2.93 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.428 |
| InChIKey | BCHGLBXVODTIEE-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1ccc(C(F)(F)F)cc1C(F)(F)F |
| Water Solubility | soluble |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2916399090 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| FXFFR B1VQ EXFFF |
| 2,4-ditrifluoromethylphenylacetic acid |
| 2,3-DIMETHYL-6-ETHYL-PYRAZINE |
| [2,4-Bis(trifluoromethyl)phenyl]acetic acid |
| 2,4-Bis(trifluoromethyl)benzeneacetic acid |
| MFCD00042492 |
| Benzeneacetic acid, 2,4-bis(trifluoromethyl)- |
| 2,4-Bis(trifluoromethyl)phenylacetic acid |