2-(3-methoxyphenyl)butanedioic acid structure
|
Common Name | 2-(3-methoxyphenyl)butanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 15378-02-6 | Molecular Weight | 224.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-methoxyphenyl)butanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12O5 |
|---|---|
| Molecular Weight | 224.21000 |
| Exact Mass | 224.06800 |
| PSA | 83.83000 |
| LogP | 1.33810 |
| InChIKey | DFRXNLZHJFZSSL-UHFFFAOYSA-N |
| SMILES | COc1cccc(C(CC(=O)O)C(=O)O)c1 |
| HS Code | 2918990090 |
|---|
|
~%
2-(3-methoxyphe... CAS#:15378-02-6 |
| Literature: Sen; Bagchi Journal of Organic Chemistry, 1955 , vol. 20, p. 845 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| m-Methoxyphenyl-bernsteinsaeure |
| Butan-1,4-diacid,2-[3-methoxyphenyl] |
| 2-(3-Methoxyphenyl)succinic acid |
| (3-Methoxy-phenyl)-bernsteinsaeure |
| 3-methoxyphenylsuccinic acid |
| 3-(3-Methoxyphenyl)succinic acid |