4-Methyl-4-(pyridin-2-yldisulfanyl)pentanoic acid structure
|
Common Name | 4-Methyl-4-(pyridin-2-yldisulfanyl)pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1537891-69-2 | Molecular Weight | 257.372 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 416.1±41.0 °C at 760 mmHg | |
| Molecular Formula | C11H15NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.5±27.6 °C | |
Use of 4-Methyl-4-(pyridin-2-yldisulfanyl)pentanoic acid4-Methyl-4-(pyridin-2-yldisulfanyl)pentanoic acid is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | 4-Methyl-4-(2-pyridinyldisulfanyl)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 4-Methyl-4-(pyridin-2-yldisulfanyl)pentanoic acid is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 416.1±41.0 °C at 760 mmHg |
| Molecular Formula | C11H15NO2S2 |
| Molecular Weight | 257.372 |
| Flash Point | 205.5±27.6 °C |
| Exact Mass | 257.054413 |
| LogP | 3.43 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | FCKSMEZVBFTODF-UHFFFAOYSA-N |
| SMILES | CC(C)(CCC(=O)O)SSc1ccccn1 |
| 4-Methyl-4-(2-pyridinyldisulfanyl)pentanoic acid |
| Pentanoic acid, 4-methyl-4-(2-pyridinyldithio)- |
| MFCD27935396 |