4-(Difluoromethoxy)nitrobenzene structure
|
Common Name | 4-(Difluoromethoxy)nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 1544-86-1 | Molecular Weight | 189.116 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 259.6±30.0 °C at 760 mmHg | |
| Molecular Formula | C7H5F2NO3 | Melting Point | 37-40 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 110.8±24.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-(difluoromethoxy)nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 259.6±30.0 °C at 760 mmHg |
| Melting Point | 37-40 °C(lit.) |
| Molecular Formula | C7H5F2NO3 |
| Molecular Weight | 189.116 |
| Flash Point | 110.8±24.6 °C |
| Exact Mass | 189.023743 |
| PSA | 55.05000 |
| LogP | 2.21 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.494 |
| InChIKey | SVGGBARCOQPYMV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OC(F)F)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| HS Code | 2909309090 |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Use of fluoroform as a source of difluorocarbene in the synthesis of N-CF2H heterocycles and difluoromethoxypyridines. Thomoson CR, et al.
J. Fluor. Chem. 168 , 34-39, (2014)
|
| MFCD00085009 |
| Benzene, 1-(difluoromethoxy)-4-nitro- |
| Difluoromethyl 4-nitrophenyl ether |
| 1-DIFLUOROMETHOXY-4-NITRO-BENZENE |
| 4-Nitro-α,α-difluoroanisole |
| 1-(Difluoromethoxy)-4-nitrobenzene |
| 4-(Difluoromethoxy)nitrobenzene |