2-(1,3-dioxoisoindol-2-yl)ethyl prop-2-enoate structure
|
Common Name | 2-(1,3-dioxoisoindol-2-yl)ethyl prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 15458-78-3 | Molecular Weight | 245.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1,3-dioxoisoindol-2-yl)ethyl prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H11NO4 |
|---|---|
| Molecular Weight | 245.23100 |
| Exact Mass | 245.06900 |
| PSA | 63.68000 |
| LogP | 0.94970 |
| InChIKey | VYIBURQFIHVDTA-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCN1C(=O)c2ccccc2C1=O |
| HS Code | 2925190090 |
|---|
|
~72%
2-(1,3-dioxoiso... CAS#:15458-78-3 |
| Literature: Dubosclard-Gottardi; Fort Synthetic Communications, 1995 , vol. 25, # 20 p. 3173 - 3180 |
|
~49%
2-(1,3-dioxoiso... CAS#:15458-78-3 |
| Literature: Dubosclard-Gottardi; Fort Synthetic Communications, 1995 , vol. 25, # 20 p. 3173 - 3180 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Propenoic acid,2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethyl ester |
| N-[2-(Acryloyloxy)ethyl]phthalimide |
| Acrylicacid,ester with 2-(2-hydroxyethyl)phthalimide (8CI) |
| 2-propenoic acid 2-phthalimidoethyl ester |
| 2-Phthalimidoethyl-acrylat |