Benzeneacetic acid,1,1'-anhydride structure
|
Common Name | Benzeneacetic acid,1,1'-anhydride | ||
|---|---|---|---|---|
| CAS Number | 1555-80-2 | Molecular Weight | 254.28100 | |
| Density | 1.174g/cm3 | Boiling Point | 388.4ºC at 760 mmHg | |
| Molecular Formula | C16H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181ºC | |
| Name | (2-phenylacetyl) 2-phenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.174g/cm3 |
|---|---|
| Boiling Point | 388.4ºC at 760 mmHg |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28100 |
| Flash Point | 181ºC |
| Exact Mass | 254.09400 |
| PSA | 43.37000 |
| LogP | 2.54160 |
| Vapour Pressure | 3.07E-06mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | JAUFWTSSYRTLLB-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccc1)OC(=O)Cc1ccccc1 |
| HS Code | 2916399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-phenylacetic anhydride |
| (PhCH2CO)2O |
| Phenyl-essigsaeure-anhydrid |
| phenylacetic acid anhydride |
| phenylacetic anhydride |
| diphenylacetic anhydride |