Benzyl 2,4-Dihydroxyphenyl Ketone structure
|
Common Name | Benzyl 2,4-Dihydroxyphenyl Ketone | ||
|---|---|---|---|---|
| CAS Number | 3669-41-8 | Molecular Weight | 228.243 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 429.8±20.0 °C at 760 mmHg | |
| Molecular Formula | C14H12O3 | Melting Point | 112-116 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 227.9±18.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2',4'-Dihydroxy-2-phenylacetophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 429.8±20.0 °C at 760 mmHg |
| Melting Point | 112-116 °C(lit.) |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.243 |
| Flash Point | 227.9±18.3 °C |
| Exact Mass | 228.078644 |
| PSA | 57.53000 |
| LogP | 3.25 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | VFQKAJVKZKHVPD-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccc1)c1ccc(O)cc1O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914501900 |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2914501900 |
|---|---|
| Summary | 2914501900 other ketone-phenols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Synthesis and study of mesogenic compounds having a methylene ketone (-CH2-CO-) linking group. Chudgar NK and Shah A.
Liq. Cryst. 14(4) , 1163-67, (1993)
|
| 2',4'-Dihydroxy-2-phenylacetophenone |
| 1-(2,4-Dihydroxyphenyl)-2-phenylethanone |
| Ethanone, 1-(2,4-dihydroxyphenyl)-2-phenyl- |
| Benzyl 2,4-Dihydroxyphenyl Ketone |
| MFCD00043754 |