Okadaic acid ammonium salt structure
|
Common Name | Okadaic acid ammonium salt | ||
|---|---|---|---|---|
| CAS Number | 155716-06-6 | Molecular Weight | 822.03 | |
| Density | N/A | Boiling Point | 947.3ºC at 760 mmHg | |
| Molecular Formula | C44H71NO13 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 526.7ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
Use of Okadaic acid ammonium saltOkadaic acid, a marine toxin, is an inhibitor of protein phosphatases (PP), including PP1 (IC50=15-50 nM), PP2A (IC50=0.1-0.3 nM), PP3 (IC50=3.7-4 nM), PP4 (IC50=0.1 nM), PP5 (IC50=3.5 nM), with a significantly higher affinity for PP2A. Okadaic acid increase of phosphorylation of a number of proteins by inhibiting PP, and acts a tumor promoter[1] [2]. |
| Name | Okadaic acid ammonium salt from Prorocentrum concavum |
|---|---|
| Synonym | More Synonyms |
| Description | Okadaic acid, a marine toxin, is an inhibitor of protein phosphatases (PP), including PP1 (IC50=15-50 nM), PP2A (IC50=0.1-0.3 nM), PP3 (IC50=3.7-4 nM), PP4 (IC50=0.1 nM), PP5 (IC50=3.5 nM), with a significantly higher affinity for PP2A. Okadaic acid increase of phosphorylation of a number of proteins by inhibiting PP, and acts a tumor promoter[1] [2]. |
|---|---|
| Related Catalog | |
| In Vitro | Okadaic acid inhibits the proliferation of AGS, MNK-45, Caco 2 cells [3].Okadaic acid (10 nM, 8 hours) increases Drp1 phosphorylation and mitochondrial fission in rat cortical neurons [4]. Cell Proliferation Assay[3] Cell Line: AGS, MNK-45 and Caco 2 cell lines Concentration: 0-100 nM Incubation Time: 24 h or 48 h Result: Inhibited the proliferation of AGS, MNK-45, Caco 2 cells. |
| In Vivo | Okadaic acid induces Tau phosphorylation and protein aggregation in anatomically distinct brain regions 24 h post-injection [5]. Animal Model: Female wild-type C57BL/6 mice (6 to 8 months)[5] Dosage: 100 μM Administration: injected unilaterally to the lateral amygdala Result: Induced Tau phosphorylation and protein aggregation in anatomically distinct brain regions 24 h post-injection. |
| References |
| Boiling Point | 947.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C44H71NO13 |
| Molecular Weight | 822.03 |
| Flash Point | 526.7ºC |
| Exact Mass | 821.49300 |
| PSA | 185.66000 |
| LogP | 4.25510 |
| Vapour Pressure | 0mmHg at 25°C |
| InChIKey | ZBOMSHVRJSJGNR-JBNKPAQWSA-N |
| SMILES | C=C1C(O)C2OC3(CCC(C=CC(C)C4CC(C)=CC5(OC(CC(C)(O)C(=O)[O-])CCC5O)O4)O3)CCC2OC1C(O)CC(C)C1OC2(CCCCO2)CCC1C.[NH4+] |
| Storage condition | 20°C |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311 + H331-H315 |
| Precautionary Statements | Missing Phrase - N15.00950417-P261-P280-P302 + P352 + P312-P304 + P340 + P312-P403 + P233 |
| Hazard Codes | T: Toxic; |
| Risk Phrases | R23/24/25 |
| Safety Phrases | 22-26-36/37/39-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| MFCD00153856 |
| okadaic acid ammonium salt |