n-butyl heptafluorobutyrate structure
|
Common Name | n-butyl heptafluorobutyrate | ||
|---|---|---|---|---|
| CAS Number | 1559-07-5 | Molecular Weight | 270.14500 | |
| Density | 1,296 g/cm3 | Boiling Point | 182-183°C | |
| Molecular Formula | C8H9F7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131-133°C | |
| Name | n-butyl heptafluorobutyrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1,296 g/cm3 |
|---|---|
| Boiling Point | 182-183°C |
| Molecular Formula | C8H9F7O2 |
| Molecular Weight | 270.14500 |
| Flash Point | 131-133°C |
| Exact Mass | 270.04900 |
| PSA | 26.30000 |
| LogP | 3.16260 |
| Vapour Pressure | 54.3mmHg at 25°C |
| Index of Refraction | 1.325 |
| InChIKey | YDXXJZKOOOJVEE-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | F: Flammable; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2915900090 |
|
~%
n-butyl heptafl... CAS#:1559-07-5 |
| Literature: Journal of the American Chemical Society, , vol. 79, p. 4759 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| MFCD00039240 |
| Heptafluor-buttersaeure-butylester |
| n-Butyl heptafluorobutyrate |
| heptafluoro-butyric acid butyl ester |
| n-Butyl-heptafluor-butyrat |