MART-1 (26-35) (human) trifluoroacetate salt structure
|
Common Name | MART-1 (26-35) (human) trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 156251-01-3 | Molecular Weight | 943.096 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 1358.4±65.0 °C at 760 mmHg | |
| Molecular Formula | C42H74N10O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 775.3±34.3 °C | |
Use of MART-1 (26-35) (human) trifluoroacetate saltMART-1 (26-35) is amino acid residue 26 to 35 of MART-1 protein. |
| Name | Melan-A, MART 1 (26-35),EAAGIGILTV |
|---|---|
| Synonym | More Synonyms |
| Description | MART-1 (26-35) is amino acid residue 26 to 35 of MART-1 protein. |
|---|---|
| Related Catalog | |
| In Vitro | MART-1 (Melan-A) gene is 18 kb long and comprises five exons. It is expressed in most melanoma tumor samples, and among normal cells, only in melanocytes[1]. In cancer immunotherapy, epitopes and variants derived from the MART-1/Melan-A protein are widely used as clinical vaccines. The epitopes spanning amino acid residues 26–35 and 27–35 from the MART-1/Melan-A protein, highly expressed in melanoma cells, provide a prime example of T cell recognition of multiple peptides and the use of peptide variants designed to elicit altered immunological responses[2]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 1358.4±65.0 °C at 760 mmHg |
| Molecular Formula | C42H74N10O14 |
| Molecular Weight | 943.096 |
| Flash Point | 775.3±34.3 °C |
| Exact Mass | 942.538574 |
| PSA | 382.75000 |
| LogP | 1.19 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | TUIOKRGNEZUFAI-UHFFFAOYSA-N |
| SMILES | CCC(C)C(NC(=O)CNC(=O)C(C)NC(=O)C(C)NC(=O)C(N)CCC(=O)O)C(=O)NCC(=O)NC(C(=O)NC(CC(C)C)C(=O)NC(C(=O)NC(C(=O)O)C(C)C)C(C)O)C(C)CC |
| Melan-A,MART 1 (26-35) |
| ANTIGEN SK29-AA (26-35) (HUMAN) |
| L-α-Glutamyl-L-alanyl-L-alanylglycyl-L-isoleucylglycyl-L-isoleucyl-L-leucyl-L-threonyl-L-valine |
| MART-1 (26-35) (HUMAN) |
| GLU-ALA-ALA-GLY-ILE-GLY-ILE-LEU-THR-VAL |
| ANTIGEN LB39-AA (26-35) (HUMAN) |
| MELAN-A PROTEIN (26-35) (HUMAN) |
| EAAGIGILTV |
| L-Valine, L-α-glutamyl-L-alanyl-L-alanylglycyl-L-isoleucylglycyl-L-isoleucyl-L-leucyl-L-threonyl- |
| MART-1 (26-35),human (3) |
| MELAN-A |
| MART 1 (26-35) |