Diethylpyridin-2,6-dicarboxylat structure
|
Common Name | Diethylpyridin-2,6-dicarboxylat | ||
|---|---|---|---|---|
| CAS Number | 15658-60-3 | Molecular Weight | 223.225 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 347.3±22.0 °C at 760 mmHg | |
| Molecular Formula | C11H13NO4 | Melting Point | 44ºC | |
| MSDS | N/A | Flash Point | 163.9±22.3 °C | |
| Name | Diethyl 2,6-Pyridinedicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 347.3±22.0 °C at 760 mmHg |
| Melting Point | 44ºC |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.225 |
| Flash Point | 163.9±22.3 °C |
| Exact Mass | 223.084457 |
| PSA | 65.49000 |
| LogP | 1.62 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.509 |
| InChIKey | KTOBUCHVPBPHMK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cccc(C(=O)OCC)n1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933399090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Diethyl 2,6-pyridinedicarboxylate |
| Diethylpyridin-2,6-dicarboxylat |
| Diethyl pyridine-2,6-dicarboxylate |
| Diethyl Dipicolinate |
| 2,6-Pyridinedicarboxylic Acid Diethyl Ester |
| MFCD00033792 |
| Dipicolinic Acid Diethyl Ester |
| 2,6-Pyridinedicarboxylic acid, diethyl ester |