[4-(Bromoacetyl)phenyl]carbamic acid phenylmethyl ester structure
|
Common Name | [4-(Bromoacetyl)phenyl]carbamic acid phenylmethyl ester | ||
|---|---|---|---|---|
| CAS Number | 157014-41-0 | Molecular Weight | 348.19100 | |
| Density | 1.486 | Boiling Point | N/A | |
| Molecular Formula | C16H14BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Benzyl (4-(2-bromoacetyl)phenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.486 |
|---|---|
| Molecular Formula | C16H14BrNO3 |
| Molecular Weight | 348.19100 |
| Exact Mass | 347.01600 |
| PSA | 55.40000 |
| LogP | 4.08590 |
| InChIKey | SGOOUOYLZRYRQG-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(C(=O)CBr)cc1)OCc1ccccc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
|
~91%
[4-(Bromoacetyl... CAS#:157014-41-0 |
| Literature: Park, Chan-Ho; Givens, Richard S. Journal of the American Chemical Society, 1997 , vol. 119, # 10 p. 2453 - 2463 |
|
~%
[4-(Bromoacetyl... CAS#:157014-41-0 |
| Literature: BASILEA PHARMACEUTICA AG; POHLMANN, Jens; BACHMANN, Felix Patent: WO2011/12577 A1, 2011 ; |
|
~%
[4-(Bromoacetyl... CAS#:157014-41-0 |
| Literature: BASILEA PHARMACEUTICA AG; POHLMANN, Jens; BACHMANN, Felix Patent: WO2011/12577 A1, 2011 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| benzyl N-[4-(2-bromoacetyl)phenyl]carbamate |
| [4-(Bromoacetyl)phenyl]carbamic acid phenylmethyl ester |
| N-Cbz-4-(2-Bromo-Acetyl)-Aniline |