p-Methacryloyloxybenzoic acid structure
|
Common Name | p-Methacryloyloxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 15721-10-5 | Molecular Weight | 206.19500 | |
| Density | 1.23g/cm3 | Boiling Point | 371.8ºC at 760mmHg | |
| Molecular Formula | C11H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.3ºC | |
| Name | 4-(2-methylprop-2-enoyloxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 371.8ºC at 760mmHg |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.19500 |
| Flash Point | 147.3ºC |
| Exact Mass | 206.05800 |
| PSA | 63.60000 |
| LogP | 1.86630 |
| Vapour Pressure | 3.47E-06mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | DNCFPDURLPJGKX-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)Oc1ccc(C(=O)O)cc1 |
| HS Code | 2918990090 |
|---|
|
~%
p-Methacryloylo... CAS#:15721-10-5 |
| Literature: Zhou, Qingzhong; Huang, Zhen Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1993 , vol. 32, # 1 p. 35 - 39 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| p-Methacryloyloxybenzoic acid |
| p-Methacryloyloxy-benzoesaeure |
| 4-methacryloxybenzoic acid |
| 4-methacryloyloxybenzoic acid |
| p-methacryloxybenzoic acid |