9-Oxo-9H-fluorene-1-carboxylic acid structure
|
Common Name | 9-Oxo-9H-fluorene-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1573-92-8 | Molecular Weight | 224.212 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 461.6±24.0 °C at 760 mmHg | |
| Molecular Formula | C14H8O3 | Melting Point | 196-198 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 247.1±19.4 °C | |
| Name | 9-fluorenone-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 461.6±24.0 °C at 760 mmHg |
| Melting Point | 196-198 °C(lit.) |
| Molecular Formula | C14H8O3 |
| Molecular Weight | 224.212 |
| Flash Point | 247.1±19.4 °C |
| Exact Mass | 224.047348 |
| PSA | 54.37000 |
| LogP | 3.26 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.701 |
| InChIKey | CBEFMGJHEKAMNI-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc2c1C(=O)c1ccccc1-2 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S37/39-S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918300090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Practical synthesis of an open geodesic polyarene with a fullerene-type 6:6-double bond at the center: diindeno[1,2,3,4-defg;1',2',3',4'-mnop]chrysene.
J. Am. Chem. Soc. 124(30) , 8870-5, (2002) Diindeno[1,2,3,4-defg;1',2',3',4'-mnop]chrysene (1), the smallest possible alkene-centered C60 substructure with a curved pi-system, is obtained in 25-35% yield by flash vacuum pyrolysis of the twiste... |
|
|
Fluoranthene degradation in Pseudomonas alcaligenes PA-10.
Biodegradation 12(6) , 393-400, (2001) Pseudomonas alcaligenes strain PA-10 degrades the four-ring polycyclic aromatic hydrocarbon fluoranthene, co-metabolically. HPLC analysis of the growth medium identified four intermediates, 9-fluoreno... |
| MFCD00011537 |
| 9-Oxo-9H-fluorene-1-carboxylic acid |
| 9H-Fluorene-1-carboxylic acid, 9-oxo- |
| 9-Fluorenone-1-carboxylic Acid |
| 9-Oxo-1-fluorenecarboxylic acid |
| EINECS 216-396-5 |
| 9-oxofluorene-1-carboxylic acid |