Tamoxifen-d5
Tamoxifen-d5 structure
|
Common Name | Tamoxifen-d5 | ||
|---|---|---|---|---|
| CAS Number | 157698-32-3 | Molecular Weight | 376.54500 | |
| Density | 1.057g/cm3 | Boiling Point | 482.3ºC at 760mmHg | |
| Molecular Formula | C26H24D5NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140ºC | |
Use of Tamoxifen-d5Tamoxifen-d5 (ICI 47699-d5) is a deuterium labeled Tamoxifen. Tamoxifen (ICI 47699) is a selective estrogen receptor modulator (SERM). Tamoxifen is a potent Hsp90 activator and enhances the Hsp90 molecular chaperone ATPase activity[1][2]. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine |
|---|---|
| Synonym | More Synonyms |
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | Tamoxifen-d5 (ICI 47699-d5) is a deuterium labeled Tamoxifen. Tamoxifen (ICI 47699) is a selective estrogen receptor modulator (SERM). Tamoxifen is a potent Hsp90 activator and enhances the Hsp90 molecular chaperone ATPase activity[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Estrogen receptor HSP90 |
| References |
[1]. Osborne CK. Tamoxifen in the treatment of breast cancer. N Engl J Med. 1998 Nov 26;339(22):1609-18. |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.057g/cm3 |
|---|---|
| Boiling Point | 482.3ºC at 760mmHg |
| Molecular Formula | C26H24D5NO |
| Molecular Weight | 376.54500 |
| Flash Point | 140ºC |
| Exact Mass | 376.25600 |
| PSA | 12.47000 |
| LogP | 5.99610 |
| Vapour Pressure | 1.85E-09mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | NKANXQFJJICGDU-FUYVPVGLSA-N |
| SMILES | CCC(=C(c1ccccc1)c1ccc(OCCN(C)C)cc1)c1ccccc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (E/Z)-Mammaton-d5 |
| Novaldex-d5 |
| Z-Tamoxifen-d5 |
| Mammaton-d5 |
| (E/Z)-Novaldex-d5 |
| (E/Z)-Tamoxifen-d5 |
| trans-Tamoxifen-d5 |
| Tamoxifen-d5 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine? |
| A: Molecular formula of N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine is C26H24D5NO. |
| Q: What is the English name of N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine? |
| A: The English name of N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine is N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine. |
| Q: What is the CAS number of N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine? |
| A: CAS number of N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine is 157698-32-3. |
| Q: What is the SMILES notation of N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine? |
| A: SMILES notation of N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine is CCC(=C(c1ccccc1)c1ccc(OCCN(C)C)cc1)c1ccccc1. |
| Q: What English synonyms does N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine have? |
| A: English synonyms of N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine: (E/Z)-Mammaton-d5, Novaldex-d5, Z-Tamoxifen-d5, Mammaton-d5, (E/Z)-Novaldex-d5, (E/Z)-Tamoxifen-d5, trans-Tamoxifen-d5, Tamoxifen-d5. |
| Q: What is the LogP of N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine? |
| A: LogP of N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine is 5.99610. |
| Q: What are the uses of N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine? |
| A: Main uses of N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine: Tamoxifen-d5 (ICI 47699-d5) is a deuterium labeled Tamoxifen. Tamoxifen (ICI 47699) is a selective estrogen receptor modulator (SERM). Tamoxifen is a potent Hsp90 activator and enhances the Hsp90 molecular chaperone ATPase activity[1][2]. |
| Q: What is the InChIKey of N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine? |
| A: InChIKey of N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine is NKANXQFJJICGDU-FUYVPVGLSA-N. |
| Q: What is the molecular weight of N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine? |
| A: Molecular weight of N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine is 376.54500. |
| Q: What is the polar surface area (PSA) of N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine? |
| A: Polar surface area (PSA) of N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine is 12.47000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |