Tamoxifen-d5 structure
|
Common Name | Tamoxifen-d5 | ||
|---|---|---|---|---|
| CAS Number | 157698-32-3 | Molecular Weight | 376.54500 | |
| Density | 1.057g/cm3 | Boiling Point | 482.3ºC at 760mmHg | |
| Molecular Formula | C26H24D5NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140ºC | |
Use of Tamoxifen-d5Tamoxifen-d5 (ICI 47699-d5) is a deuterium labeled Tamoxifen. Tamoxifen (ICI 47699) is a selective estrogen receptor modulator (SERM). Tamoxifen is a potent Hsp90 activator and enhances the Hsp90 molecular chaperone ATPase activity[1][2]. |
| Name | N,N-dimethyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine |
|---|---|
| Synonym | More Synonyms |
| Description | Tamoxifen-d5 (ICI 47699-d5) is a deuterium labeled Tamoxifen. Tamoxifen (ICI 47699) is a selective estrogen receptor modulator (SERM). Tamoxifen is a potent Hsp90 activator and enhances the Hsp90 molecular chaperone ATPase activity[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Estrogen receptor HSP90 |
| References |
[1]. Osborne CK. Tamoxifen in the treatment of breast cancer. N Engl J Med. 1998 Nov 26;339(22):1609-18. |
| Density | 1.057g/cm3 |
|---|---|
| Boiling Point | 482.3ºC at 760mmHg |
| Molecular Formula | C26H24D5NO |
| Molecular Weight | 376.54500 |
| Flash Point | 140ºC |
| Exact Mass | 376.25600 |
| PSA | 12.47000 |
| LogP | 5.99610 |
| Vapour Pressure | 1.85E-09mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | NKANXQFJJICGDU-FUYVPVGLSA-N |
| SMILES | CCC(=C(c1ccccc1)c1ccc(OCCN(C)C)cc1)c1ccccc1 |
| (E/Z)-Mammaton-d5 |
| Novaldex-d5 |
| Z-Tamoxifen-d5 |
| Mammaton-d5 |
| (E/Z)-Novaldex-d5 |
| (E/Z)-Tamoxifen-d5 |
| trans-Tamoxifen-d5 |
| Tamoxifen-d5 |