5,5'-methylenebis(1H-benzotriazole) structure
|
Common Name | 5,5'-methylenebis(1H-benzotriazole) | ||
|---|---|---|---|---|
| CAS Number | 15805-10-4 | Molecular Weight | 250.259 | |
| Density | 1.502 | Boiling Point | 543.1±60.0 °C at 760 mmHg | |
| Molecular Formula | C13H10N6 | Melting Point | 238-240 ºC | |
| MSDS | N/A | Flash Point | 261.9±25.8 °C | |
| Name | 5-(2H-benzotriazol-5-ylmethyl)-2H-benzotriazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.502 |
|---|---|
| Boiling Point | 543.1±60.0 °C at 760 mmHg |
| Melting Point | 238-240 ºC |
| Molecular Formula | C13H10N6 |
| Molecular Weight | 250.259 |
| Flash Point | 261.9±25.8 °C |
| Exact Mass | 250.096695 |
| PSA | 83.14000 |
| LogP | 2.06 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.819 |
| InChIKey | IWASLBFJTMJYHF-UHFFFAOYSA-N |
| SMILES | c1cc2n[nH]nc2cc1Cc1ccc2n[nH]nc2c1 |
| Hazard Codes | F |
|---|---|
| HS Code | 2933990090 |
|
~94%
5,5'-methyleneb... CAS#:15805-10-4 |
| Literature: Gu, Haining; Yu, Biao; Zhang, Peng-Fei; Xu, Wei-Ming Organic Preparations and Procedures International, 2009 , vol. 41, # 2 p. 162 - 164 |
|
~%
5,5'-methyleneb... CAS#:15805-10-4 |
| Literature: Meyer,J.; Rohmer Chemische Berichte, 1900 , vol. 33, p. 254 |
|
~%
5,5'-methyleneb... CAS#:15805-10-4 |
| Literature: Meyer,J.; Rohmer Chemische Berichte, 1900 , vol. 33, p. 254 |
|
~%
5,5'-methyleneb... CAS#:15805-10-4 |
| Literature: Meyer,J.; Rohmer Chemische Berichte, 1900 , vol. 33, p. 254 |
|
~%
5,5'-methyleneb... CAS#:15805-10-4 |
| Literature: Meyer,J.; Rohmer Chemische Berichte, 1900 , vol. 33, p. 254 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,5'-methylene-bis(benzotriazole) |
| 1H-1,2,3-benzotriazole, 6,6'-methylenebis- |
| 5,5'-methylenebis(1H-benzotriazole) |
| Methane,bis(5-benzotriazolyl) |
| 1H-Benzotriazole,5,5'-methylenebis |
| Bis-(1H-benzotriazol-5-yl)-methan |
| 2H-1,2,3-Benzotriazole, 5,5'-methylenebis- |
| 1H-1,2,3-benzotriazole, 5,5'-methylenebis- |
| 5,5'-Methylenebis(2H-benzotriazole) |
| 6,6'-Methylenebis(1H-benzotriazole) |
| bis-(1H-benzotriazol-5-yl)-methane |
| 5,5'-methylenebis-1H-Benzotriazole |