Benzenamine, 4,4'-methylenebis[2-nitro- structure
|
Common Name | Benzenamine, 4,4'-methylenebis[2-nitro- | ||
|---|---|---|---|---|
| CAS Number | 17474-44-1 | Molecular Weight | 288.25900 | |
| Density | 1.462g/cm3 | Boiling Point | 559ºC at 760mmHg | |
| Molecular Formula | C13H12N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.9ºC | |
| Name | 4-[(4-amino-3-nitrophenyl)methyl]-2-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.462g/cm3 |
|---|---|
| Boiling Point | 559ºC at 760mmHg |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.25900 |
| Flash Point | 291.9ºC |
| Exact Mass | 288.08600 |
| PSA | 143.68000 |
| LogP | 4.46700 |
| Vapour Pressure | 1.57E-12mmHg at 25°C |
| Index of Refraction | 1.711 |
| InChIKey | WJLPZRZKWVPCMN-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Cc2ccc(N)c([N+](=O)[O-])c2)cc1[N+](=O)[O-] |
| HS Code | 2921590090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3.3'-Dinitro-4.4'-diamino-diphenylmethan |
| 3,3'-dinitro-4,4'-diaminodiphenylmethane |