3F8 structure
|
Common Name | 3F8 | ||
|---|---|---|---|---|
| CAS Number | 159109-11-2 | Molecular Weight | 286.28300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3F83F8 is a potent and selective GSK-3β inhibitor that could be useful as new reagent and potential therapeutic candidate for GSK3 related diseases[1]. |
| Name | 5-Ethyl-7,8-dimethoxy-1H-pyrrolo[3,4-c]isoquinoline-1,3(2H)-dione |
|---|
| Description | 3F8 is a potent and selective GSK-3β inhibitor that could be useful as new reagent and potential therapeutic candidate for GSK3 related diseases[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H14N2O4 |
|---|---|
| Molecular Weight | 286.28300 |
| Exact Mass | 286.09500 |
| PSA | 81.01000 |
| LogP | 1.70840 |
| InChIKey | ULVWJFBHQIXEPE-UHFFFAOYSA-N |
| SMILES | CCc1nc2c(c3cc(OC)c(OC)cc13)C(=O)NC2=O |
| Storage condition | -20°C |