tert-butyl (4-iodophenyl)carbamate structure
|
Common Name | tert-butyl (4-iodophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 159217-89-7 | Molecular Weight | 319.139 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 299.0±23.0 °C at 760 mmHg | |
| Molecular Formula | C11H14INO2 | Melting Point | 146-147ºC | |
| MSDS | Chinese USA | Flash Point | 134.6±22.6 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | N-Boc-4-iodoaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 299.0±23.0 °C at 760 mmHg |
| Melting Point | 146-147ºC |
| Molecular Formula | C11H14INO2 |
| Molecular Weight | 319.139 |
| Flash Point | 134.6±22.6 °C |
| Exact Mass | 319.006927 |
| PSA | 38.33000 |
| LogP | 4.42 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | CGALRQWBJFDAKN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(I)cc1 |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H317-H410 |
| Precautionary Statements | P273-P280-P501 |
| RIDADR | UN 3077 9 / PGIII |
| HS Code | 2924299090 |
|
~99%
tert-butyl (4-i... CAS#:159217-89-7 |
| Literature: Jin, Yi; Zhou, Zu-Yu; Tian, Wei; Yu, Qiang; Long, Ya-Qiu Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 22 p. 5864 - 5869 |
|
~82%
tert-butyl (4-i... CAS#:159217-89-7 |
| Literature: Gallo, Rafael D.C.; Ferreira, Irlon M.; Casagrande, Gleison A.; Pizzuti, Lucas; Oliveira-Silva, Diogo; Raminelli, Cristiano Tetrahedron Letters, 2012 , vol. 53, # 40 p. 5372 - 5375 |
|
~90%
tert-butyl (4-i... CAS#:159217-89-7 |
| Literature: Yokoyama, Akihiro; Maruyama, Takurou; Tagami, Kei; Masu, Hyuma; Katagiri, Kosuke; Azumaya, Isao; Yokozawa, Tsutomu Organic Letters, 2008 , vol. 10, # 15 p. 3207 - 3210 |
|
~%
tert-butyl (4-i... CAS#:159217-89-7 |
| Literature: US5346914 A1, ; US 5346914 A |
| Precursor 4 | |
|---|---|
| DownStream 7 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| tert-butyl n-(4-iodophenyl)carbamate |
| 2-Methyl-2-propanyl (4-iodophenyl)carbamate |
| Carbamic acid, N-(4-iodophenyl)-, 1,1-dimethylethyl ester |
| tert-butyl (4-iodophenyl)carbamate |