4-(Boc-amino)benzoic acid structure
|
Common Name | 4-(Boc-amino)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 66493-39-8 | Molecular Weight | 237.252 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 336.2±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H15NO4 | Melting Point | 200ºC | |
| MSDS | USA | Flash Point | 157.1±23.2 °C | |
| Name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 336.2±25.0 °C at 760 mmHg |
| Melting Point | 200ºC |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.252 |
| Flash Point | 157.1±23.2 °C |
| Exact Mass | 237.100113 |
| PSA | 75.63000 |
| LogP | 3.11 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | ZJDBQMWMDZEONW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(=O)O)cc1 |
| Storage condition | 2-8°C |
| Precursor 7 | |
|---|---|
| DownStream 9 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Structure-activity relationships of a series of substituted benzamides: potent D2/5-HT2 antagonists and 5-HT1a agonists as neuroleptic agents.
J. Med. Chem. 39 , 1172, (1996) A series of substituted (4-(4-(1,2-benzisothiazol-3-yl)-1-piperazinyl)butyl)benzamide derivatives was prepared and evaluated as potential atypical antipsychotic agents. The target compounds were readi... |
| 4-[(tert-butoxycarbonyl)amino]benzoic acid |
| MFCD00037428 |
| Benzoic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]- |
| 4-(Boc-amino)benzoic Acid |
| N-Boc-p-aminobenzoic acid |
| 4-(t-butyloxycarbonylamino)-benzoic acid |
| N-tert-butoxycarbonyl-para-aminobenzoic acid |
| 4-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid |
| N-Boc-4-aminobenzoic acid |
| Boc-4-amino benzoic acid |
| Boc-4-Abz-OH |