MSN-125 structure
|
Common Name | MSN-125 | ||
|---|---|---|---|---|
| CAS Number | 1592908-16-1 | Molecular Weight | 688.619 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H38BrN3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MSN-125MSN-125 (MSN 125, MSN125) is a small molecule Bax inhibitor that inhibits Bax/Bak oligomerization and prevents mitochondrial outer membrane permeabilization (MOMP) with IC50 of 4 uM; potently inhibits Bax/Bak-mediated apoptosis in HCT-116, BMK Cells, and primary cortical neurons, protects primary neurons against glutamate excitotoxicity. |
| Name | MSN-125 |
|---|
| Description | MSN-125 (MSN 125, MSN125) is a small molecule Bax inhibitor that inhibits Bax/Bak oligomerization and prevents mitochondrial outer membrane permeabilization (MOMP) with IC50 of 4 uM; potently inhibits Bax/Bak-mediated apoptosis in HCT-116, BMK Cells, and primary cortical neurons, protects primary neurons against glutamate excitotoxicity. |
|---|---|
| Related Catalog | |
| Target |
Bax Bak |
| In Vitro | MSN-125 inhibits tBid/Bax-mediated MOMP in a concentration-dependent manner[1]. |
| References |
| Molecular Formula | C36H38BrN3O6 |
|---|---|
| Molecular Weight | 688.619 |
| InChIKey | NUPXNNVRTSEHSR-IGOOQNSHSA-N |
| SMILES | COCCOCOc1ccc2c(c1)OC(CN)C2N(Cc1ccc(Br)cc1)C(=O)C(Cc1ccccc1)NC(=O)c1ccccc1 |
| Hazard Codes | Xi |
|---|