Ketoprofen structure
|
Common Name | Ketoprofen | ||
|---|---|---|---|---|
| CAS Number | 159490-55-8 | Molecular Weight | 254.281 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 431.3±28.0 °C at 760 mmHg | |
| Molecular Formula | C16H14O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 228.8±20.5 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | Ketoprofen |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 431.3±28.0 °C at 760 mmHg |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.281 |
| Flash Point | 228.8±20.5 °C |
| Exact Mass | 254.094299 |
| LogP | 2.81 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | DKYWVDODHFEZIM-FIBGUPNXSA-N |
| SMILES | CC(C(=O)O)c1cccc(C(=O)c2ccccc2)c1 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H319-H335 |
| Precautionary Statements | P261-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Phrases | 25-36/37/38 |
| Safety Phrases | 26-45 |
| RIDADR | UN 2811 6.1 / PGIII |
|
Innovative sampling and extraction methods for the determination of nonsteroidal anti-inflammatory drugs in water.
J. Pharm. Biomed. Anal. 106 , 100-6, (2015) Two different innovative approaches were used for the determination of nonsteroidal anti-inflammatory drugs (NSAIDs) in water: stir bar sorptive extraction (SBSE) and passive sampling, followed by ele... |
|
|
Multi-residue analysis of 90 emerging contaminants in liquid and solid environmental matrices by ultra-high-performance liquid chromatography tandem mass spectrometry.
J. Chromatogr. A. 1431 , 64-78, (2016) Reported herein is new analytical methodology for the determination of 90 emerging contaminants (ECs) in liquid environmental matrices (crude wastewater, final effluent and river water). The applicati... |
|
|
Photolytic fate and genotoxicity of benzophenone-derived compounds and their photodegradation mixtures in the aqueous environment.
Chemosphere 147 , 114-23, (2016) This study investigates the environmental fate of eight benzophenone derivatives (the pharmaceutical ketoprofen, its phototransformation products 3-ethylbenzophenone and 3-acetylbenzophenone, and five... |
| 2-(3-benzoyl-phenyl)propionic acid |
| Ketoprophene |
| Ketopron |
| UNII:90Y4QC304K |
| Lertus |
| Ketoprofen |
| Dexal |
| Menamin |
| Meprofen |
| Fastum |
| racemic-Ketoprofen |
| Orugesic |
| Iso-K |
| Oscorel |
| 2-(m-Benzoylphenyl)propionic acid |
| Oruvail |
| Toprec |
| Racemic Ketoprofen |
| Toprek |
| 2-(3-Benzoylphenyl)propanoic acid |
| Kefenid |
| Ketoflam |
| Orudis |
| Benzeneacetic acid, 3-benzoyl-α-methyl- |
| benzeneacetic acid, 3-benzoyl-a-methyl- |
| Enantyum |
| (±)-Ketoprofen |
| 2-(3-benzoylphenyl)propionic acid |