H-Phe-Gly-Gly-Phe-OH
Modify Date: 2025-09-11 08:43:50
H-Phe-Gly-Gly-Phe-OH structure
|
Common Name | H-Phe-Gly-Gly-Phe-OH | ||
|---|---|---|---|---|
| CAS Number | 40204-87-3 | Molecular Weight | 426.46600 | |
| Density | 1.285g/cm3 | Boiling Point | 834.2ºC at 760 mmHg | |
| Molecular Formula | C22H26N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 458.3ºC | |
| Name | 2-[[2-[[2-[(2-amino-3-phenylpropanoyl)amino]acetyl]amino]acetyl]amino]-3-phenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.285g/cm3 |
|---|---|
| Boiling Point | 834.2ºC at 760 mmHg |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.46600 |
| Flash Point | 458.3ºC |
| Exact Mass | 426.19000 |
| PSA | 150.62000 |
| LogP | 1.47390 |
| Index of Refraction | 1.598 |
| InChIKey | NWFLONJLUJYCNS-UHFFFAOYSA-N |
| SMILES | NC(Cc1ccccc1)C(=O)NCC(=O)NCC(=O)NC(Cc1ccccc1)C(=O)O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Phe-Gly-Gly-Phe |
| (2S)-2-[[2-[[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]acetyl]amino]acetyl]amino]-3-phenylpropanoic acid |
| H-PHE-GLY-GLY-PHE-OH |