5-BroMo-4-chloro-3-indolyl-α-D-N-acetylneuraMinic acid sodiuM salt structure
|
Common Name | 5-BroMo-4-chloro-3-indolyl-α-D-N-acetylneuraMinic acid sodiuM salt | ||
|---|---|---|---|---|
| CAS Number | 160369-85-7 | Molecular Weight | 559.725 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H21BrClN2NaO9 | Melting Point | 183℃ dec. | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of 5-BroMo-4-chloro-3-indolyl-α-D-N-acetylneuraMinic acid sodiuM saltX-Neu5Ac is a novel substrate for chromogenic assay of neuraminidase activity in bacterial expression systems. |
| Name | 5-Bromo-4-chloro-3-indolyl-α-D-N-acetylneuraminic Acid, Sodium Salt |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 183℃ dec. |
|---|---|
| Molecular Formula | C19H21BrClN2NaO9 |
| Molecular Weight | 559.725 |
| Exact Mass | 558.001648 |
| PSA | 184.40000 |
| InChIKey | MNWWXEDVLXNFDD-GNZCRVNMSA-M |
| SMILES | CC(=O)NC1C(O)CC(Oc2c[nH]c3ccc(Br)c(Cl)c23)(C(=O)[O-])OC1C(O)C(O)CO.[Na+] |
| Storage condition | −20°C |
| Stability | Moisture, Temperature sensitive |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 1 |
|
X-Neu5Ac: a novel substrate for chromogenic assay of neuraminidase activity in bacterial expression systems.
Bioorg. Med. Chem. 1 , 147, (1993) A chromogenic substrate 1, 5-bromo-4-chloroindol-3-yl 5-acetamido-3,5-dideoxy-alpha-D-glycero-D-galacto-2-nonulopyranosidon ic acid (X-Neu5Ac), has been synthesized to facilitate the screening of bact... |
|
|
Versatile dual reporter gene systems for investigating stop codon readthrough in plants.
PLoS ONE 4 , e7354, (2009) Translation is most often terminated when a ribosome encounters the first in-frame stop codon (UAA, UAG or UGA) in an mRNA. However, many viruses (and some cellular mRNAs) contain "stop" codons that c... |
| 5-Bromo-4-chloro-3-indolyl α-D-N-acetylneuraminic acid sodium salt (X-NeuNAc) |
| 5-Bromo-4-chloro-3-indolyl-α-D-N-acetylneuraminic acid sodium salt |
| D-glycero-α-D-galacto-2-Nonulopyranosidonic acid, 5-bromo-4-chloro-1H-indol-3-yl 5-(acetylamino)-3,5-dideoxy-, sodium salt (1:1) |
| 5-Bromo-4-chloro-3-indolyl α-D-N-acetylneuraminic acid sodium salt |
| Sodium 5-bromo-4-chloro-1H-indol-3-yl (6R)-5-acetamido-3,5-dideoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]-β-L-threo-hex-2-ulopyranosidonate |