ethyl 6-cyclohexyl-6-oxohexanoate structure
|
Common Name | ethyl 6-cyclohexyl-6-oxohexanoate | ||
|---|---|---|---|---|
| CAS Number | 16076-62-3 | Molecular Weight | 240.33900 | |
| Density | 1g/cm3 | Boiling Point | 346.138ºC at 760 mmHg | |
| Molecular Formula | C14H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.604ºC | |
| Name | ethyl 6-cyclohexyl-6-oxohexanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 346.138ºC at 760 mmHg |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.33900 |
| Flash Point | 149.604ºC |
| Exact Mass | 240.17300 |
| PSA | 43.37000 |
| LogP | 3.25930 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.465 |
| InChIKey | YMTFBDCTGQKTQB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCC(=O)C1CCCCC1 |
| HS Code | 2918300090 |
|---|
|
~91%
ethyl 6-cyclohe... CAS#:16076-62-3 |
| Literature: Shimizu, Toshiaki; Seki, Masahiko Tetrahedron Letters, 2002 , vol. 43, # 6 p. 1039 - 1042 |
|
~%
ethyl 6-cyclohe... CAS#:16076-62-3 |
| Literature: Journal of the American Chemical Society, , vol. 70, p. 2859,2861 |
|
~%
ethyl 6-cyclohe... CAS#:16076-62-3 |
| Literature: Journal of the American Chemical Society, , vol. 70, p. 2859,2861 |
|
~%
ethyl 6-cyclohe... CAS#:16076-62-3 |
| Literature: Journal of the American Chemical Society, , vol. 70, p. 2859,2861 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 6-Cyclohexyl-6-oxo-hexansaeure-aethylester |
| 6-cyclohexyl-6-oxo-hexanoic acid ethyl ester |