B I09 structure
|
Common Name | B I09 | ||
|---|---|---|---|---|
| CAS Number | 1607803-67-7 | Molecular Weight | 303.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of B I09B I09 is an IRE-1 RNase inhibitor, with an IC50 of 1230 nM. |
| Name | B I09 |
|---|
| Description | B I09 is an IRE-1 RNase inhibitor, with an IC50 of 1230 nM. |
|---|---|
| Related Catalog | |
| Target |
IC50: 1230 nM (IRE-1 RNase)[1]. |
| In Vitro | B I09 is an IRE-1 RNase inhibitor, with an IC50 of 1230 nM[1]. Treatment of CLL cells with this inhibitor (B I09) mimick XBP-1 deficiency, including upregulation of IRE-1 expression and compromised BCR signaling. B I09 is highly effective in inhibiting splicing of XBP1 mRNA in human WaC3 cells and the expression of XBP-1s in LPS stimulated B cells[2]. |
| In Vivo | B I09 has a halflife of approximately 1.5 hours and reaches its peak concentration of approximately 39 μM in mouse plasma serum 15 minutes after administration. Administration of B I09 to CLL tumor-bearing mice suppress leukemic progression by inducing apoptosis and do not cause systemic toxicity[2]. |
| Animal Admin | Mice[2] Mice are intraperitoneally injected with B I09 (50 mg/kg) on the first 5 days of each week for 3 weeks[2]. |
| References |
| Molecular Formula | C16H17NO5 |
|---|---|
| Molecular Weight | 303.31 |
| InChIKey | UYYMWNUDIOPESF-UHFFFAOYSA-N |
| SMILES | O=c1oc2c(C3OCCCO3)c(O)ccc2c2c1CNCC2 |