Ethyl N-Cbz-piperidine-4-carboxylate structure
|
Common Name | Ethyl N-Cbz-piperidine-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 160809-38-1 | Molecular Weight | 291.34200 | |
| Density | 1.166g/cm3 | Boiling Point | 403.712ºC at 760 mmHg | |
| Molecular Formula | C16H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.958ºC | |
| Name | Ethyl 1-Cbz-Piperidine-4-Carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.166g/cm3 |
|---|---|
| Boiling Point | 403.712ºC at 760 mmHg |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.34200 |
| Flash Point | 197.958ºC |
| Exact Mass | 291.14700 |
| PSA | 55.84000 |
| LogP | 2.53620 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | XXDBOGXZKIODTO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(C(=O)OCc2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
|
~95%
Ethyl N-Cbz-pip... CAS#:160809-38-1 |
| Literature: MERCK SHARP and DOHME LIMITED Patent: WO2004/78750 A1, 2004 ; Location in patent: Page 64 ; WO 2004/078750 A1 |
|
~%
Ethyl N-Cbz-pip... CAS#:160809-38-1 |
| Literature: EP1553074 A1, ; Page/Page column 47-48 ; |
|
~99%
Ethyl N-Cbz-pip... CAS#:160809-38-1 |
| Literature: Patel, Sunil; Waykole, Liladhar; Repic, Oljan; Chen, Kau-Ming Synthetic Communications, 1996 , vol. 26, # 24 p. 4699 - 4710 |
|
~%
Ethyl N-Cbz-pip... CAS#:160809-38-1 |
| Literature: Tetrahedron Letters, , vol. 48, # 2 p. 199 - 202 |
| Precursor 5 | |
|---|---|
| DownStream 9 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl N-Cbz-piperidine-4-carboxylate |
| 1-O-benzyl 4-O-ethyl piperidine-1,4-dicarboxylate |
| Ethyl 1-Cbz-piperidine-4-carboxylate |
| 1-BENZYL 4-ETHYL PIPERIDINE-1,4-DICARBOXYLATE |