CHEMBRDG-BB 6555065 structure
|
Common Name | CHEMBRDG-BB 6555065 | ||
|---|---|---|---|---|
| CAS Number | 160816-43-3 | Molecular Weight | 235.23600 | |
| Density | 1.32g/cm3 | Boiling Point | 469.6ºC at 760 mmHg | |
| Molecular Formula | C12H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-(morpholine-4-carbonyl)benzoic acid |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 469.6ºC at 760 mmHg |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.23600 |
| Flash Point | 237.8ºC |
| Exact Mass | 235.08400 |
| PSA | 66.84000 |
| LogP | 0.79510 |
| Vapour Pressure | 1.27E-09mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | BFTPXPCTGHARJF-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(C(=O)N2CCOCC2)cc1 |
|
~90%
CHEMBRDG-BB 6555065 CAS#:160816-43-3 |
| Literature: Angelastro; Baugh; Bey; Burkhart; Chen; Durham; Hare; Huber; Janusz; Koehl; Marquart; Mehdi; Peet Journal of Medicinal Chemistry, 1994 , vol. 37, # 26 p. 4538 - 4553 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |