(3,5-Ditert-butyl-4-hydroxyphenyl)acetonitrile structure
|
Common Name | (3,5-Ditert-butyl-4-hydroxyphenyl)acetonitrile | ||
|---|---|---|---|---|
| CAS Number | 1611-07-0 | Molecular Weight | 245.360 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 323.0±37.0 °C at 760 mmHg | |
| Molecular Formula | C16H23NO | Melting Point | 104 °C | |
| MSDS | N/A | Flash Point | 149.2±26.5 °C | |
| Name | 3,5-di-tert-butyl-4-hydroxyphenylacetonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 323.0±37.0 °C at 760 mmHg |
| Melting Point | 104 °C |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.360 |
| Flash Point | 149.2±26.5 °C |
| Exact Mass | 245.177963 |
| PSA | 44.02000 |
| LogP | 4.09 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | BEQZSRGZHCDMMH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(CC#N)cc(C(C)(C)C)c1O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | S22-S36/37/39-S45 |
| RIDADR | 3276 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2926909090 |
|
~87%
(3,5-Ditert-but... CAS#:1611-07-0 |
| Literature: Kang, Tae-Souk; Jo, Hyang-Ok; Park, Woo-Kyu; Kim, Jong-Pyung; Konishi, Yasuo; Kong, Jae-Yang; Park, No-Sang; Jung, Young-Sik Bioorganic and Medicinal Chemistry Letters, 2008 , vol. 18, # 5 p. 1663 - 1667 |
|
~%
(3,5-Ditert-but... CAS#:1611-07-0 |
| Literature: US4487722 A1, ; |
|
~%
(3,5-Ditert-but... CAS#:1611-07-0 |
| Literature: Tetrahedron, , vol. 24, p. 103 - 115 |
|
~%
(3,5-Ditert-but... CAS#:1611-07-0 |
| Literature: Tetrahedron, , vol. 24, p. 103 - 115 |
| Precursor 6 | |
|---|---|
| DownStream 4 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| [4-Hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]acetonitrile |
| Benzeneacetonitrile, 3,5-bis(1,1-dimethylethyl)-4-hydroxy- |
| 2-[3,5-di(tert-butyl)-4-hydroxyphenyl]acetonitrile |
| 2,6-Bis(1,1-dimethylethyl)-4-cyanomethylphenol |
| (3,5-Ditert-butyl-4-hydroxyphenyl)acetonitrile |
| (3,5-Di-tert-butyl-4-hydroxyphenyl)acetonitrile |
| MFCD00156139 |
| 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetonitrile |
| 3,5-Di-tert-butyl-4-hydroxyphenylacetonitrile |