3,5-di-tert-butyl-4-hydroxyphenylacetic acid structure
|
Common Name | 3,5-di-tert-butyl-4-hydroxyphenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 1611-03-6 | Molecular Weight | 264.36000 | |
| Density | 1.063g/cm3 | Boiling Point | 348.9ºC at 760mmHg | |
| Molecular Formula | C16H24O3 | Melting Point | 157 °C | |
| MSDS | N/A | Flash Point | 179ºC | |
| Name | 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.063g/cm3 |
|---|---|
| Boiling Point | 348.9ºC at 760mmHg |
| Melting Point | 157 °C |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36000 |
| Flash Point | 179ºC |
| Exact Mass | 264.17300 |
| PSA | 57.53000 |
| LogP | 3.61430 |
| Vapour Pressure | 1.83E-05mmHg at 25°C |
| InChIKey | QLMGIWHWWWXXME-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(CC(=O)O)cc(C(C)(C)C)c1O |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | R61:May cause harm to the unborn child. R40:Limited evidence of a carcinogenic effect. |
| Safety Phrases | S53-S36/37/39-S45 |
| WGK Germany | 3 |
| RTECS | BV8052000 |
| HS Code | 2918290000 |
|
~%
3,5-di-tert-but... CAS#:1611-03-6 |
| Literature: Tetrahedron, , vol. 24, p. 103 - 115 |
|
~%
3,5-di-tert-but... CAS#:1611-03-6 |
| Literature: Tetrahedron, , vol. 24, p. 103 - 115 |
|
~%
3,5-di-tert-but... CAS#:1611-03-6 |
| Literature: Tetrahedron, , vol. 24, p. 103 - 115 |
|
~%
3,5-di-tert-but... CAS#:1611-03-6 |
| Literature: Justus Liebigs Annalen der Chemie, , p. 757 - 770 |
|
~30%
3,5-di-tert-but... CAS#:1611-03-6 |
| Literature: Portevin, Bernard; Lonchampt, Michel; Canet, Emmanuel; De Nanteuil, Guillaume Journal of Medicinal Chemistry, 1997 , vol. 40, # 12 p. 1906 - 1918 |
|
~%
3,5-di-tert-but... CAS#:1611-03-6 |
| Literature: Journal of the American Chemical Society, , vol. 121, # 24 p. 5625 - 5632 |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 3,5-di-tert-butyl-4-hydroxyphenyl acetic acid |
| 4-hydroxy-3,5-di-tert-butylphenylacetic acid |
| 3,5-di-t-butyl-4-hydroxyphenyl-acetic acid |
| MFCD00156138 |
| 2-[3,5-di(tert-butyl)-4-hydroxyphenyl]acetic acid |