4,5,6,7-tetrachloro-2-(1,3-thiazol-2-yl)isoindole-1,3-dione structure
|
Common Name | 4,5,6,7-tetrachloro-2-(1,3-thiazol-2-yl)isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 16131-68-3 | Molecular Weight | 368.02300 | |
| Density | 1.865g/cm3 | Boiling Point | 613.1ºC at 760 mmHg | |
| Molecular Formula | C11H2Cl4N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 324.6ºC | |
| Name | 4,5,6,7-tetrachloro-2-(1,3-thiazol-2-yl)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.865g/cm3 |
|---|---|
| Boiling Point | 613.1ºC at 760 mmHg |
| Molecular Formula | C11H2Cl4N2O2S |
| Molecular Weight | 368.02300 |
| Flash Point | 324.6ºC |
| Exact Mass | 365.85900 |
| PSA | 78.51000 |
| LogP | 4.62230 |
| Vapour Pressure | 5.72E-15mmHg at 25°C |
| Index of Refraction | 1.722 |
| InChIKey | IKOWLLJVZFQYDU-UHFFFAOYSA-N |
| SMILES | O=C1c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)N1c1nccs1 |
| HS Code | 2934100090 |
|---|
|
~%
4,5,6,7-tetrach... CAS#:16131-68-3 |
| Literature: Rice,L.M. et al. Journal of Medicinal Chemistry, 1968 , vol. 11, # 1 p. 183 - 185 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4,5,6,7-tetrabromo-2-(1,3-thiazol-2-yl)-1h-isoindole-1,3(2h)-dione |
| 1H-Isoindole-1,3(2H)-dione,4,5,6,7-tetrabromo-2-(2-thiazolyl) |
| N-(2-Thiazolyl)-3,4,5,6-tetrabrom-phthalsaeureimid |
| 4,5,6,7-tetrabromo-2-thiazol-2-yl-isoindole-1,3-dione |
| N-(2-Thiazolyl)-3,4,5,6-tetrachlor-phthalsaeureimid |
| 4,5,6,7-tetrachloro-2-thiazol-2-yl-isoindole-1,3-dione |