6-Azidohexanoyl-Val-Cit-PAB-PNP structure
|
Common Name | 6-Azidohexanoyl-Val-Cit-PAB-PNP | ||
|---|---|---|---|---|
| CAS Number | 1613321-01-9 | Molecular Weight | 518.61 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H38N8O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 6-Azidohexanoyl-Val-Cit-PAB-PNP6-Azidohexanoyl-Val-Cit-PAB-PNP is a click chemistry reagent that can be used to synthesis |
| Name | 6-Azidohexanoyl-Val-Cit-PAB-PNP |
|---|
| Description | 6-Azidohexanoyl-Val-Cit-PAB-PNP is a click chemistry reagent that can be used to synthesis |
|---|---|
| Related Catalog |
| Molecular Formula | C24H38N8O5 |
|---|---|
| Molecular Weight | 518.61 |
| InChIKey | RMDFMOLSVRETCO-BDYUSTAISA-N |
| SMILES | CC(C)C(NC(=O)CCCCCN=[N+]=[N-])C(=O)NC(CCCNC(N)=O)C(=O)Nc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |