6-Azidohexanoyl-Val-Cit-PAB structure
|
Common Name | 6-Azidohexanoyl-Val-Cit-PAB | ||
|---|---|---|---|---|
| CAS Number | 1613321-02-0 | Molecular Weight | 683.71 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H41N9O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 6-Azidohexanoyl-Val-Cit-PAB6-Azidohexanoyl-Val-Cit-PAB is a click chemistry reagent that can be used to synthesis vaccine[1]. |
| Name | 6-Azidohexanoyl-Val-Cit-PAB |
|---|
| Description | 6-Azidohexanoyl-Val-Cit-PAB is a click chemistry reagent that can be used to synthesis vaccine[1]. |
|---|---|
| Related Catalog |
| Molecular Formula | C31H41N9O9 |
|---|---|
| Molecular Weight | 683.71 |
| InChIKey | OVDFBASRMLDVQT-FPOVZHCZSA-N |
| SMILES | CC(C)C(NC(=O)CCCCCN=[N+]=[N-])C(=O)NC(CCCNC(N)=O)C(=O)Nc1ccc(CO)cc1 |