3-Fluoro-5-trifluoromethylbenzoic acid structure
|
Common Name | 3-Fluoro-5-trifluoromethylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 161622-05-5 | Molecular Weight | 208.110 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 239.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H4F4O2 | Melting Point | 104 °C | |
| MSDS | Chinese USA | Flash Point | 98.7±27.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-Fluoro-5-(trifluoromethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 239.6±40.0 °C at 760 mmHg |
| Melting Point | 104 °C |
| Molecular Formula | C8H4F4O2 |
| Molecular Weight | 208.110 |
| Flash Point | 98.7±27.3 °C |
| Exact Mass | 208.014740 |
| PSA | 37.30000 |
| LogP | 3.06 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.459 |
| InChIKey | NSGKIIGVPBTOBF-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(F)cc(C(F)(F)F)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2916399090 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Novel small molecule bradykinin B1 receptor antagonists. Part 1: benzamides and semicarbazides.
Bioorg. Med. Chem. Lett. 20(3) , 1225-8, (2010) The synthesis and SAR of two series of bradykinin B(1) receptor antagonists is described. The benzamide moiety proved to be a suitable replacement for the aryl ester functionality of biaryl based anta... |
| MFCD00061293 |
| α,α,α,5-Tetrafluoro-m-toluic acid |
| QVR CF EXFFF |
| 3-fluoro-5-trifluoromethylbenzoic acid |
| 3-Fluoro-5-(trifluoromethyl)benzoic acid |
| Benzoic acid, 3-fluoro-5-(trifluoromethyl)- |