Talampanel structure
|
Common Name | Talampanel | ||
|---|---|---|---|---|
| CAS Number | 161832-65-1 | Molecular Weight | 337.372 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 528.9±60.0 °C at 760 mmHg | |
| Molecular Formula | C19H19N3O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 273.7±32.9 °C | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
Use of TalampanelTalampanel is a potent and selective AMPA-receptor antagonist, is a potential new antiepileptic drug (AED). Target: AMPA [1]in vitro: Talampanel is a glutamate receptor inhibitor with anti-seizure activity.in vivo: Talampanel reduces motoneuronal calcium in a mouse model of ALS, but its effi cacy declines as the disease progresses, suggesting that medication initiation in the earlier stages of the disease might be more effective. [2] |
| Name | 1-[(8R)-5-(4-aminophenyl)-8-methyl-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-7-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Description | Talampanel is a potent and selective AMPA-receptor antagonist, is a potential new antiepileptic drug (AED). Target: AMPA [1]in vitro: Talampanel is a glutamate receptor inhibitor with anti-seizure activity.in vivo: Talampanel reduces motoneuronal calcium in a mouse model of ALS, but its effi cacy declines as the disease progresses, suggesting that medication initiation in the earlier stages of the disease might be more effective. [2] |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 528.9±60.0 °C at 760 mmHg |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.372 |
| Flash Point | 273.7±32.9 °C |
| Exact Mass | 337.142639 |
| PSA | 77.15000 |
| LogP | 1.23 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.675 |
| InChIKey | JACAAXNEHGBPOQ-LLVKDONJSA-N |
| SMILES | CC(=O)N1N=C(c2ccc(N)cc2)c2cc3c(cc2CC1C)OCO3 |
| Storage condition | 2-8℃ |
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H410 |
| Precautionary Statements | P273-P301 + P310-P501 |
| RIDADR | UN2811 - class 6.1 - PG 3 - EHS - Toxic solids, organic, n.o.s., HI: all |
| Kinampa |
| Talampanel |
| (R)-7-acetyl-5-(4-aminophenyl)-8-methyl-8,9-dihydro-7H-1,3-dioxolo[4,5-h][2,3]benzodiazepine |
| 1-[(8R)-5-(4-Aminophenyl)-8-methyl-8,9-dihydro-7H-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-7-yl]ethanone |
| Ethanone, 1-[(8R)-5-(4-aminophenyl)-8,9-dihydro-8-methyl-7H-1,3-dioxolo[4,5-h][2,3]benzodiazepin-7-yl]- |
| Ampanel |
| (R)-(-)-1-(4-aminophenyl)-3-acetyl-4-methyl-7,8-methylenedioxy-3,4-dihydro-5H-2,3-benzodiazepine |
| (R)-7-Acetyl-5-(p-aminophenyl)-8,9-dihydro-8-methyl-7H-1,3-dioxolo[4,5-h][2,3]benzodiazepine |
| Talampanel (INN) |
| (R)-7-acetyl-5-(4-aminophenyl)-8,9-dihydro-8-methyl-7H-1,3-dioxolo[4,5-h][2,3]benzo-diazepine |