2-(p-Aminoanilino)-4-phenyl-thiazole structure
|
Common Name | 2-(p-Aminoanilino)-4-phenyl-thiazole | ||
|---|---|---|---|---|
| CAS Number | 1619-40-5 | Molecular Weight | 267.34900 | |
| Density | 1.299g/cm3 | Boiling Point | 489.2ºC at 760mmHg | |
| Molecular Formula | C15H13N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.7ºC | |
| Name | N-(4-Phenyl-1,3-thiazol-2-yl)-1,4-benzenediamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.299g/cm3 |
|---|---|
| Boiling Point | 489.2ºC at 760mmHg |
| Molecular Formula | C15H13N3S |
| Molecular Weight | 267.34900 |
| Flash Point | 249.7ºC |
| Exact Mass | 267.08300 |
| PSA | 79.18000 |
| LogP | 4.79010 |
| Vapour Pressure | 1.02E-09mmHg at 25°C |
| Index of Refraction | 1.716 |
| InChIKey | UCTKBXRPOAHLQM-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Nc2nc(-c3ccccc3)cs2)cc1 |
| HS Code | 2934100090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| N-4-Diphenyl-trifluoracetamid |
| 4-Trifluoroacetylaminobiphenyl |
| 2,2,2-trifluoro-4'-phenylacetanilide |
| Trifluor-essigsaeure-biphenyl-4-ylamid |
| trifluoro-acetic acid biphenyl-4-ylamide |