2-(m-Aminoanilino)-4-phenyl-thiazole structure
|
Common Name | 2-(m-Aminoanilino)-4-phenyl-thiazole | ||
|---|---|---|---|---|
| CAS Number | 1619-41-6 | Molecular Weight | 267.34900 | |
| Density | 1.299g/cm3 | Boiling Point | 488.9ºC at 760mmHg | |
| Molecular Formula | C15H13N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.5ºC | |
| Name | 3-N-(4-phenyl-1,3-thiazol-2-yl)benzene-1,3-diamine |
|---|
| Density | 1.299g/cm3 |
|---|---|
| Boiling Point | 488.9ºC at 760mmHg |
| Molecular Formula | C15H13N3S |
| Molecular Weight | 267.34900 |
| Flash Point | 249.5ºC |
| Exact Mass | 267.08300 |
| PSA | 82.41000 |
| LogP | 4.13900 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.716 |
| InChIKey | MUNMQVLAUQOQES-UHFFFAOYSA-N |
| SMILES | Nc1cccc(Nc2nc(-c3ccccc3)cs2)c1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |