Ethyl 5-phenyl-1H-pyrrole-3-carboxylate structure
|
Common Name | Ethyl 5-phenyl-1H-pyrrole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 161958-61-8 | Molecular Weight | 215.24800 | |
| Density | 1.148g/cm3 | Boiling Point | 421.644ºC at 760 mmHg | |
| Molecular Formula | C13H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.803ºC | |
| Name | ethyl 5-phenyl-1h-pyrrole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.148g/cm3 |
|---|---|
| Boiling Point | 421.644ºC at 760 mmHg |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.24800 |
| Flash Point | 208.803ºC |
| Exact Mass | 215.09500 |
| PSA | 42.09000 |
| LogP | 2.85840 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | XGAUDZLAAYUFKN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c[nH]c(-c2ccccc2)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 5-phenylpyrrole-3-carboxylate |
| 5-phenyl-1H-pyrrole-3-carboxylic acid ethyl ester |