2,7-Diiodo-9,10-phenanthrenedione structure
|
Common Name | 2,7-Diiodo-9,10-phenanthrenedione | ||
|---|---|---|---|---|
| CAS Number | 16218-32-9 | Molecular Weight | 460.005 | |
| Density | 2.3±0.1 g/cm3 | Boiling Point | 547.1±43.0 °C at 760 mmHg | |
| Molecular Formula | C14H6I2O2 | Melting Point | 309-310ºC | |
| MSDS | N/A | Flash Point | 284.7±28.2 °C | |
| Name | 2,7-diiodophenanthrene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 2.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 547.1±43.0 °C at 760 mmHg |
| Melting Point | 309-310ºC |
| Molecular Formula | C14H6I2O2 |
| Molecular Weight | 460.005 |
| Flash Point | 284.7±28.2 °C |
| Exact Mass | 459.845703 |
| PSA | 34.14000 |
| LogP | 5.19 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.770 |
| InChIKey | FJEXTLBWOUQIBN-UHFFFAOYSA-N |
| SMILES | O=C1C(=O)c2cc(I)ccc2-c2ccc(I)cc21 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2914700090 |
|
~94%
2,7-Diiodo-9,10... CAS#:16218-32-9 |
| Literature: Chaudhuri, Debangshu; Wettach, Henning; Van Schooten, Kipp J.; Liu, Su; Sigmund, Eva; Hoeger, Sigurd; Lupton, John M. Angewandte Chemie - International Edition, 2010 , vol. 49, # 42 p. 7714 - 7717 |
|
~32%
2,7-Diiodo-9,10... CAS#:16218-32-9 |
| Literature: Russian Journal of Organic Chemistry, , vol. 34, # 7 p. 997 - 999 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2,7-Diiodophenanthrenequinone |
| 2,7-diiodo-9,10-phenanthrenequinone |
| 2,7-diodophenanthrenequinone |
| 2,7-diiodo-phenanthrene-9,10-dione |
| 2,7-diiodophenanthrene-9,10-quinone |
| 2,7-Diiodo-9,10-phenanthrenedione |
| 9,10-Phenanthrenedione, 2,7-diiodo- |
| 2,7-diiodophenanthren-9,10-dione |
| 2,7-diiodo-9,10-phenenthrenequinone |
| ZLD0612 |